C17H28O6S2 — CID 10938037
[(3aR,3bS,6aR,7aR)-6a-methyl-3-methylidene-4-(methylsulfonyloxymethyl)-1,2,3a,3b,5,6,7,7a-octahydrocyclopenta[a]pentalen-4-yl]methyl methanesulfonate (PubChem CID 10938037) has the molecular formula C17H28O6S2 and a molecular weight of 392.54 g/mol. Its IUPAC name is [(3aR,3bS,6aR,7aR)-6a-methyl-3-methylidene-4-(methylsulfonyloxymethyl)-1,2,3a,3b,5,6,7,7a-octahydrocyclopenta[a]pentalen-4-yl]methyl methanesulfonate.
| Compound Name | [(3aR,3bS,6aR,7aR)-6a-methyl-3-methylidene-4-(methylsulfonyloxymethyl)-1,2,3a,3b,5,6,7,7a-octahydrocyclopenta[a]pentalen-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 10938037 |
| Molecular Formula | C17H28O6S2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | [(3aR,3bS,6aR,7aR)-6a-methyl-3-methylidene-4-(methylsulfonyloxymethyl)-1,2,3a,3b,5,6,7,7a-octahydrocyclopenta[a]pentalen-4-yl]methyl methanesulfonate |
| SMILES | C=C1CC[C@@H]2C[C@@]3(C)CCC(COS(C)(=O)=O)(COS(C)(=O)=O)[C@H]3[C@H]12 |
| InChI | InChI=1S/C17H28O6S2/c1-12-5-6-13-9-16(2)7-8-17(15(16)14(12)13,10-22-24(3,18)19)11-23-25(4,20)21/h13-15H,1,5-11H2,2-4H3/t13-,14-,15+,16-/m1/s1 |
| InChIKey | SNRJEQXCQRGMBD-LVQVYYBASA-N |
| XLogP | 2.33 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|