C16H23N3O2 — CID 109380508
N-(3-hydroxy-2,2,4-trimethylpentyl)-1H-indazole-7-carboxamide (PubChem CID 109380508) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-(3-hydroxy-2,2,4-trimethylpentyl)-1H-indazole-7-carboxamide.
| Compound Name | N-(3-hydroxy-2,2,4-trimethylpentyl)-1H-indazole-7-carboxamide |
|---|---|
| PubChem CID | 109380508 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | N-(3-hydroxy-2,2,4-trimethylpentyl)-1H-indazole-7-carboxamide |
| SMILES | CC(C)C(O)C(C)(C)CNC(=O)c1cccc2cn[nH]c12 |
| InChI | InChI=1S/C16H23N3O2/c1-10(2)14(20)16(3,4)9-17-15(21)12-7-5-6-11-8-18-19-13(11)12/h5-8,10,14,20H,9H2,1-4H3,(H,17,21)(H,18,19) |
| InChIKey | KFEQFDNXPXUFHW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |