C21H35NO2SSi — CID 10938065
(2S,3S,4S,5R)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3,5-dimethyl-6-phenylsulfanylhexanenitrile (PubChem CID 10938065) has the molecular formula C21H35NO2SSi and a molecular weight of 393.67 g/mol. Its IUPAC name is (2S,3S,4S,5R)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3,5-dimethyl-6-phenylsulfanylhexanenitrile.
| Compound Name | (2S,3S,4S,5R)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3,5-dimethyl-6-phenylsulfanylhexanenitrile |
|---|---|
| PubChem CID | 10938065 |
| Molecular Formula | C21H35NO2SSi |
| Molecular Weight | 393.67 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | (2S,3S,4S,5R)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3,5-dimethyl-6-phenylsulfanylhexanenitrile |
| SMILES | CO[C@@H]([C@H](C)[C@@H](C#N)O[Si](C)(C)C(C)(C)C)[C@@H](C)CSc1ccccc1 |
| InChI | InChI=1S/C21H35NO2SSi/c1-16(15-25-18-12-10-9-11-13-18)20(23-6)17(2)19(14-22)24-26(7,8)21(3,4)5/h9-13,16-17,19-20H,15H2,1-8H3/t16-,17+,19+,20+/m0/s1 |
| InChIKey | MSSVMJARZKYCKE-ONCXSQPRSA-N |
| XLogP | 5.98 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.67 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|