C18H28N2O3 — CID 109381094
N-(3-hydroxy-2,2,4-trimethylpentyl)-3-(propanoylamino)benzamide (PubChem CID 109381094) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is N-(3-hydroxy-2,2,4-trimethylpentyl)-3-(propanoylamino)benzamide.
| Compound Name | N-(3-hydroxy-2,2,4-trimethylpentyl)-3-(propanoylamino)benzamide |
|---|---|
| PubChem CID | 109381094 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | N-(3-hydroxy-2,2,4-trimethylpentyl)-3-(propanoylamino)benzamide |
| SMILES | CCC(=O)Nc1cccc(C(=O)NCC(C)(C)C(O)C(C)C)c1 |
| InChI | InChI=1S/C18H28N2O3/c1-6-15(21)20-14-9-7-8-13(10-14)17(23)19-11-18(4,5)16(22)12(2)3/h7-10,12,16,22H,6,11H2,1-5H3,(H,19,23)(H,20,21) |
| InChIKey | CZPKRQNIKIHOAD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |