C16H26N2O2 — CID 109381247
N-(3-hydroxy-2,2,4-trimethylpentyl)-3-pyridin-4-ylpropanamide (PubChem CID 109381247) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is N-(3-hydroxy-2,2,4-trimethylpentyl)-3-pyridin-4-ylpropanamide.
| Compound Name | N-(3-hydroxy-2,2,4-trimethylpentyl)-3-pyridin-4-ylpropanamide |
|---|---|
| PubChem CID | 109381247 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | N-(3-hydroxy-2,2,4-trimethylpentyl)-3-pyridin-4-ylpropanamide |
| SMILES | CC(C)C(O)C(C)(C)CNC(=O)CCc1ccncc1 |
| InChI | InChI=1S/C16H26N2O2/c1-12(2)15(20)16(3,4)11-18-14(19)6-5-13-7-9-17-10-8-13/h7-10,12,15,20H,5-6,11H2,1-4H3,(H,18,19) |
| InChIKey | RKNWBMHJPCZAEE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |