About 3-[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]-N-propylpropanamide;hydroiodide
3-[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]-N-propylpropanamide;hydroiodide (PubChem CID 109381449) has the molecular formula C14H29IN4O2
and a molecular weight of 412.32 g/mol. Its IUPAC name is 3-[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]-N-propylpropanamide;hydroiodide.
Molecular Properties
| Compound Name | 3-[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]-N-propylpropanamide;hydroiodide |
| PubChem CID | 109381449 |
| Molecular Formula | C14H29IN4O2 |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 3-[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]-N-propylpropanamide;hydroiodide |
| SMILES | CCCNC(=O)CCN/C(=N\C)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C14H28N4O2.HI/c1-4-7-16-13(19)5-8-17-14(15-2)18(3)10-12-6-9-20-11-12;/h12H,4-11H2,1-3H3,(H,15,17)(H,16,19);1H |
| InChIKey | YHEACPVOMPIWJF-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]-N-propylpropanamide;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]-N-propylpropanamide;hydroiodide?
The IUPAC name of 3-[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]-N-propylpropanamide;hydroiodide (CID 109381449) is 3-[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]-N-propylpropanamide;hydroiodide.
What is the SMILES notation for 3-[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]-N-propylpropanamide;hydroiodide?
The canonical SMILES for 3-[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]-N-propylpropanamide;hydroiodide is CCCNC(=O)CCN/C(=N\C)N(C)CC1CCOC1.I.
What is the InChIKey of 3-[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]-N-propylpropanamide;hydroiodide?
The InChIKey is YHEACPVOMPIWJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N4O2.HI/c1-4-7-16-13(19)5-8-17-14(15-2)18(3)10-12-6-9-20-11-12;/h12H,4-11H2,1-3H3,(H,15,17)(H,16,19);1H.
What are the key properties of 3-[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]-N-propylpropanamide;hydroiodide?
3-[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]-N-propylpropanamide;hydroiodide has a molecular weight of 412.32 g/mol, XLogP of 1.06, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]-N-propylpropanamide;hydroiodide is sourced from PubChem (CID 109381449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).