About 3-(3,3-dimethylbutyl)-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide
3-(3,3-dimethylbutyl)-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109381475) has the molecular formula C14H30IN3O
and a molecular weight of 383.32 g/mol. Its IUPAC name is 3-(3,3-dimethylbutyl)-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
Molecular Properties
| Compound Name | 3-(3,3-dimethylbutyl)-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| PubChem CID | 109381475 |
| Molecular Formula | C14H30IN3O |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 3-(3,3-dimethylbutyl)-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC(C)(C)C)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C14H29N3O.HI/c1-14(2,3)7-8-16-13(15-4)17(5)10-12-6-9-18-11-12;/h12H,6-11H2,1-5H3,(H,15,16);1H |
| InChIKey | JJXYHVBRTVPTNQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,3-dimethylbutyl)-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-dimethylbutyl)-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide?
The IUPAC name of 3-(3,3-dimethylbutyl)-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (CID 109381475) is 3-(3,3-dimethylbutyl)-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
What is the SMILES notation for 3-(3,3-dimethylbutyl)-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide?
The canonical SMILES for 3-(3,3-dimethylbutyl)-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide is C/N=C(\NCCC(C)(C)C)N(C)CC1CCOC1.I.
What is the InChIKey of 3-(3,3-dimethylbutyl)-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide?
The InChIKey is JJXYHVBRTVPTNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29N3O.HI/c1-14(2,3)7-8-16-13(15-4)17(5)10-12-6-9-18-11-12;/h12H,6-11H2,1-5H3,(H,15,16);1H.
What are the key properties of 3-(3,3-dimethylbutyl)-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide?
3-(3,3-dimethylbutyl)-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide has a molecular weight of 383.32 g/mol, XLogP of 2.58, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-dimethylbutyl)-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide is sourced from PubChem (CID 109381475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).