C19H37N3O2 — CID 109381780
3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[(1-propoxycyclohexyl)methyl]guanidine (PubChem CID 109381780) has the molecular formula C19H37N3O2 and a molecular weight of 339.52 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[(1-propoxycyclohexyl)methyl]guanidine.
| Compound Name | 3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[(1-propoxycyclohexyl)methyl]guanidine |
|---|---|
| PubChem CID | 109381780 |
| Molecular Formula | C19H37N3O2 |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.29 |
| IUPAC Name | 3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[(1-propoxycyclohexyl)methyl]guanidine |
| SMILES | CCCOC1(C/N=C(\NCC)N(C)CC2CCOC2)CCCCC1 |
| InChI | InChI=1S/C19H37N3O2/c1-4-12-24-19(10-7-6-8-11-19)16-21-18(20-5-2)22(3)14-17-9-13-23-15-17/h17H,4-16H2,1-3H3,(H,20,21) |
| InChIKey | RFMKGVKDLRECRT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|