C21H38O5Si — CID 10938184
1-[(3aR,4R,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)-3a,4,5,6,7,7a-hexahydro-3H-inden-1-yl]ethanone (PubChem CID 10938184) has the molecular formula C21H38O5Si and a molecular weight of 398.62 g/mol. Its IUPAC name is 1-[(3aR,4R,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)-3a,4,5,6,7,7a-hexahydro-3H-inden-1-yl]ethanone.
| Compound Name | 1-[(3aR,4R,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)-3a,4,5,6,7,7a-hexahydro-3H-inden-1-yl]ethanone |
|---|---|
| PubChem CID | 10938184 |
| Molecular Formula | C21H38O5Si |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | 1-[(3aR,4R,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)-3a,4,5,6,7,7a-hexahydro-3H-inden-1-yl]ethanone |
| SMILES | COCCOCO[C@@H]1CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2C(C(C)=O)=CC[C@H]21 |
| InChI | InChI=1S/C21H38O5Si/c1-15(22)16-8-9-17-18(25-14-24-13-12-23-5)10-11-19(20(16)17)26-27(6,7)21(2,3)4/h8,17-20H,9-14H2,1-7H3/t17-,18+,19-,20+/m0/s1 |
| InChIKey | DVCBYLMRPLGEHJ-ZGXWSNOMSA-N |
| XLogP | 4.33 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|