C18H36N4O3 — CID 109382202
tert-butyl N-[1-[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]pentan-2-yl]carbamate (PubChem CID 109382202) has the molecular formula C18H36N4O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is tert-butyl N-[1-[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]pentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 109382202 |
| Molecular Formula | C18H36N4O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.28 |
| IUPAC Name | tert-butyl N-[1-[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]pentan-2-yl]carbamate |
| SMILES | CCCC(CN/C(=N\C)N(C)CC1CCOC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H36N4O3/c1-7-8-15(21-17(23)25-18(2,3)4)11-20-16(19-5)22(6)12-14-9-10-24-13-14/h14-15H,7-13H2,1-6H3,(H,19,20)(H,21,23) |
| InChIKey | QCGNGXSPYKOCCB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|