C25H40O2Si — CID 10938236
(1R,8S,13S)-13-[tert-butyl(dimethyl)silyl]oxy-12,15,15-trimethyl-9-methylidenetricyclo[9.3.1.03,8]pentadeca-3,11-dien-2-one (PubChem CID 10938236) has the molecular formula C25H40O2Si and a molecular weight of 400.68 g/mol. Its IUPAC name is (1R,8S,13S)-13-[tert-butyl(dimethyl)silyl]oxy-12,15,15-trimethyl-9-methylidenetricyclo[9.3.1.03,8]pentadeca-3,11-dien-2-one.
| Compound Name | (1R,8S,13S)-13-[tert-butyl(dimethyl)silyl]oxy-12,15,15-trimethyl-9-methylidenetricyclo[9.3.1.03,8]pentadeca-3,11-dien-2-one |
|---|---|
| PubChem CID | 10938236 |
| Molecular Formula | C25H40O2Si |
| Molecular Weight | 400.68 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | (1R,8S,13S)-13-[tert-butyl(dimethyl)silyl]oxy-12,15,15-trimethyl-9-methylidenetricyclo[9.3.1.03,8]pentadeca-3,11-dien-2-one |
| SMILES | C=C1CC2=C(C)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H](C(=O)C3=CCCC[C@@H]13)C2(C)C |
| InChI | InChI=1S/C25H40O2Si/c1-16-14-20-17(2)22(27-28(8,9)24(3,4)5)15-21(25(20,6)7)23(26)19-13-11-10-12-18(16)19/h13,18,21-22H,1,10-12,14-15H2,2-9H3/t18-,21-,22-/m0/s1 |
| InChIKey | QOYMDRZLRHMCFT-NYVOZVTQSA-N |
| XLogP | 6.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.68 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|