C24H41IN4O3 — CID 109382367
tert-butyl N-[2-[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]-1-(4-propan-2-ylphenyl)ethyl]carbamate;hydroiodide (PubChem CID 109382367) has the molecular formula C24H41IN4O3 and a molecular weight of 560.52 g/mol. Its IUPAC name is tert-butyl N-[2-[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]-1-(4-propan-2-ylphenyl)ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]-1-(4-propan-2-ylphenyl)ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 109382367 |
| Molecular Formula | C24H41IN4O3 |
| Molecular Weight | 560.52 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | tert-butyl N-[2-[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]-1-(4-propan-2-ylphenyl)ethyl]carbamate;hydroiodide |
| SMILES | C/N=C(/NCC(NC(=O)OC(C)(C)C)c1ccc(C(C)C)cc1)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C24H40N4O3.HI/c1-17(2)19-8-10-20(11-9-19)21(27-23(29)31-24(3,4)5)14-26-22(25-6)28(7)15-18-12-13-30-16-18;/h8-11,17-18,21H,12-16H2,1-7H3,(H,25,26)(H,27,29);1H |
| InChIKey | KDQAHKMRHNXPIL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|