C19H37IN4O3 — CID 109382473
tert-butyl 4-[[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide (PubChem CID 109382473) has the molecular formula C19H37IN4O3 and a molecular weight of 496.43 g/mol. Its IUPAC name is tert-butyl 4-[[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 109382473 |
| Molecular Formula | C19H37IN4O3 |
| Molecular Weight | 496.43 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | tert-butyl 4-[[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide |
| SMILES | C/N=C(/NCC1CCN(C(=O)OC(C)(C)C)CC1)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C19H36N4O3.HI/c1-19(2,3)26-18(24)23-9-6-15(7-10-23)12-21-17(20-4)22(5)13-16-8-11-25-14-16;/h15-16H,6-14H2,1-5H3,(H,20,21);1H |
| InChIKey | DNHDFJGMWKLQBV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|