About azepan-1-yl-[5-(2,4-dichlorophenyl)-1,2-oxazol-3-yl]methanone
azepan-1-yl-[5-(2,4-dichlorophenyl)-1,2-oxazol-3-yl]methanone (PubChem CID 1093827) has the molecular formula C16H16Cl2N2O2
and a molecular weight of 339.22 g/mol. Its IUPAC name is azepan-1-yl-[5-(2,4-dichlorophenyl)-1,2-oxazol-3-yl]methanone.
Molecular Properties
| Compound Name | azepan-1-yl-[5-(2,4-dichlorophenyl)-1,2-oxazol-3-yl]methanone |
| PubChem CID | 1093827 |
| Molecular Formula | C16H16Cl2N2O2 |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | azepan-1-yl-[5-(2,4-dichlorophenyl)-1,2-oxazol-3-yl]methanone |
| SMILES | O=C(c1cc(-c2ccc(Cl)cc2Cl)on1)N1CCCCCC1 |
| InChI | InChI=1S/C16H16Cl2N2O2/c17-11-5-6-12(13(18)9-11)15-10-14(19-22-15)16(21)20-7-3-1-2-4-8-20/h5-6,9-10H,1-4,7-8H2 |
| InChIKey | QUEBCBGFFOQOQW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azepan-1-yl-[5-(2,4-dichlorophenyl)-1,2-oxazol-3-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azepan-1-yl-[5-(2,4-dichlorophenyl)-1,2-oxazol-3-yl]methanone?
The IUPAC name of azepan-1-yl-[5-(2,4-dichlorophenyl)-1,2-oxazol-3-yl]methanone (CID 1093827) is azepan-1-yl-[5-(2,4-dichlorophenyl)-1,2-oxazol-3-yl]methanone.
What is the SMILES notation for azepan-1-yl-[5-(2,4-dichlorophenyl)-1,2-oxazol-3-yl]methanone?
The canonical SMILES for azepan-1-yl-[5-(2,4-dichlorophenyl)-1,2-oxazol-3-yl]methanone is O=C(c1cc(-c2ccc(Cl)cc2Cl)on1)N1CCCCCC1.
What is the InChIKey of azepan-1-yl-[5-(2,4-dichlorophenyl)-1,2-oxazol-3-yl]methanone?
The InChIKey is QUEBCBGFFOQOQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16Cl2N2O2/c17-11-5-6-12(13(18)9-11)15-10-14(19-22-15)16(21)20-7-3-1-2-4-8-20/h5-6,9-10H,1-4,7-8H2.
What are the key properties of azepan-1-yl-[5-(2,4-dichlorophenyl)-1,2-oxazol-3-yl]methanone?
azepan-1-yl-[5-(2,4-dichlorophenyl)-1,2-oxazol-3-yl]methanone has a molecular weight of 339.22 g/mol, XLogP of 4.66, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azepan-1-yl-[5-(2,4-dichlorophenyl)-1,2-oxazol-3-yl]methanone is sourced from PubChem (CID 1093827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).