C20H39IN4O — CID 109382839
2-[2-[bis(prop-2-enyl)amino]-3-methylbutyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109382839) has the molecular formula C20H39IN4O and a molecular weight of 478.46 g/mol. Its IUPAC name is 2-[2-[bis(prop-2-enyl)amino]-3-methylbutyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-[2-[bis(prop-2-enyl)amino]-3-methylbutyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109382839 |
| Molecular Formula | C20H39IN4O |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | 2-[2-[bis(prop-2-enyl)amino]-3-methylbutyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C=CCN(CC=C)C(C/N=C(\NCC)N(C)CC1CCOC1)C(C)C.I |
| InChI | InChI=1S/C20H38N4O.HI/c1-7-11-24(12-8-2)19(17(4)5)14-22-20(21-9-3)23(6)15-18-10-13-25-16-18;/h7-8,17-19H,1-2,9-16H2,3-6H3,(H,21,22);1H |
| InChIKey | NFXNWQXWYFKBFM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|