C24H37NO4 — CID 10938316
methyl (3S,4R)-5-[(4S)-4-benzyl-2,2,5,5-tetramethyl-1,3-oxazolidin-3-yl]-4-methyl-5-oxo-3-propan-2-ylpentanoate (PubChem CID 10938316) has the molecular formula C24H37NO4 and a molecular weight of 403.56 g/mol. Its IUPAC name is methyl (3S,4R)-5-[(4S)-4-benzyl-2,2,5,5-tetramethyl-1,3-oxazolidin-3-yl]-4-methyl-5-oxo-3-propan-2-ylpentanoate.
| Compound Name | methyl (3S,4R)-5-[(4S)-4-benzyl-2,2,5,5-tetramethyl-1,3-oxazolidin-3-yl]-4-methyl-5-oxo-3-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 10938316 |
| Molecular Formula | C24H37NO4 |
| Molecular Weight | 403.56 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | methyl (3S,4R)-5-[(4S)-4-benzyl-2,2,5,5-tetramethyl-1,3-oxazolidin-3-yl]-4-methyl-5-oxo-3-propan-2-ylpentanoate |
| SMILES | COC(=O)C[C@@H](C(C)C)[C@@H](C)C(=O)N1[C@@H](Cc2ccccc2)C(C)(C)OC1(C)C |
| InChI | InChI=1S/C24H37NO4/c1-16(2)19(15-21(26)28-8)17(3)22(27)25-20(14-18-12-10-9-11-13-18)23(4,5)29-24(25,6)7/h9-13,16-17,19-20H,14-15H2,1-8H3/t17-,19+,20+/m1/s1 |
| InChIKey | BRNUPWHEYKEFKV-HOJAQTOUSA-N |
| XLogP | 4.44 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.56 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |