C19H37IN4O — CID 109383227
3-[2-[bis(prop-2-enyl)amino]-3-methylbutyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109383227) has the molecular formula C19H37IN4O and a molecular weight of 464.44 g/mol. Its IUPAC name is 3-[2-[bis(prop-2-enyl)amino]-3-methylbutyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 3-[2-[bis(prop-2-enyl)amino]-3-methylbutyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109383227 |
| Molecular Formula | C19H37IN4O |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 3-[2-[bis(prop-2-enyl)amino]-3-methylbutyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C=CCN(CC=C)C(CN/C(=N\C)N(C)CC1CCOC1)C(C)C.I |
| InChI | InChI=1S/C19H36N4O.HI/c1-7-10-23(11-8-2)18(16(3)4)13-21-19(20-5)22(6)14-17-9-12-24-15-17;/h7-8,16-18H,1-2,9-15H2,3-6H3,(H,20,21);1H |
| InChIKey | ALNOVWNDHLDQCJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|