C22H28ClN3O3 — CID 10938642
benzyl N-[(2S)-1-[2-(3-chloroanilino)ethylamino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 10938642) has the molecular formula C22H28ClN3O3 and a molecular weight of 417.94 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[2-(3-chloroanilino)ethylamino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[2-(3-chloroanilino)ethylamino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 10938642 |
| Molecular Formula | C22H28ClN3O3 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | benzyl N-[(2S)-1-[2-(3-chloroanilino)ethylamino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)NCCNc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H28ClN3O3/c1-16(2)13-20(26-22(28)29-15-17-7-4-3-5-8-17)21(27)25-12-11-24-19-10-6-9-18(23)14-19/h3-10,14,16,20,24H,11-13,15H2,1-2H3,(H,25,27)(H,26,28)/t20-/m0/s1 |
| InChIKey | DUKPLGVLCQMBIL-FQEVSTJZSA-N |
| XLogP | 4.21 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|