C19H28F2N4O — CID 109386651
3-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine (PubChem CID 109386651) has the molecular formula C19H28F2N4O and a molecular weight of 366.46 g/mol. Its IUPAC name is 3-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 3-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109386651 |
| Molecular Formula | C19H28F2N4O |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 3-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine |
| SMILES | C/N=C(/NCC1CCN(c2ccc(F)c(F)c2)C1)N(C)CC1CCOC1 |
| InChI | InChI=1S/C19H28F2N4O/c1-22-19(24(2)11-15-6-8-26-13-15)23-10-14-5-7-25(12-14)16-3-4-17(20)18(21)9-16/h3-4,9,14-15H,5-8,10-13H2,1-2H3,(H,22,23) |
| InChIKey | RMXCXZHPPWGAIY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|