C16H33N3O3 — CID 109386877
3-ethyl-2-[4-(2-methoxyethoxy)butyl]-1-methyl-1-(oxolan-3-ylmethyl)guanidine (PubChem CID 109386877) has the molecular formula C16H33N3O3 and a molecular weight of 315.46 g/mol. Its IUPAC name is 3-ethyl-2-[4-(2-methoxyethoxy)butyl]-1-methyl-1-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 3-ethyl-2-[4-(2-methoxyethoxy)butyl]-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109386877 |
| Molecular Formula | C16H33N3O3 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.25 |
| IUPAC Name | 3-ethyl-2-[4-(2-methoxyethoxy)butyl]-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\CCCCOCCOC)N(C)CC1CCOC1 |
| InChI | InChI=1S/C16H33N3O3/c1-4-17-16(19(2)13-15-7-10-22-14-15)18-8-5-6-9-21-12-11-20-3/h15H,4-14H2,1-3H3,(H,17,18) |
| InChIKey | BUANHTAWAGFDQN-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|