C23H41N5O2 — CID 109387057
1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-3-[2-[di(propan-2-yl)amino]ethyl]-2-methylguanidine (PubChem CID 109387057) has the molecular formula C23H41N5O2 and a molecular weight of 419.61 g/mol. Its IUPAC name is 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-3-[2-[di(propan-2-yl)amino]ethyl]-2-methylguanidine.
| Compound Name | 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-3-[2-[di(propan-2-yl)amino]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 109387057 |
| Molecular Formula | C23H41N5O2 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.33 |
| IUPAC Name | 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-3-[2-[di(propan-2-yl)amino]ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCN(C(C)C)C(C)C)NC1CCN(c2cc(OC)cc(OC)c2)CC1 |
| InChI | InChI=1S/C23H41N5O2/c1-17(2)28(18(3)4)13-10-25-23(24-5)26-19-8-11-27(12-9-19)20-14-21(29-6)16-22(15-20)30-7/h14-19H,8-13H2,1-7H3,(H2,24,25,26) |
| InChIKey | FJDRZPFUTFJNFI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|