C21H42O4S2 — CID 10938767
2-[(2R,4R,6R,10R)-2,4,6,10-tetramethoxytridecyl]-1,3-dithiane (PubChem CID 10938767) has the molecular formula C21H42O4S2 and a molecular weight of 422.70 g/mol. Its IUPAC name is 2-[(2R,4R,6R,10R)-2,4,6,10-tetramethoxytridecyl]-1,3-dithiane.
| Compound Name | 2-[(2R,4R,6R,10R)-2,4,6,10-tetramethoxytridecyl]-1,3-dithiane |
|---|---|
| PubChem CID | 10938767 |
| Molecular Formula | C21H42O4S2 |
| Molecular Weight | 422.70 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 2-[(2R,4R,6R,10R)-2,4,6,10-tetramethoxytridecyl]-1,3-dithiane |
| SMILES | CCC[C@H](CCC[C@H](C[C@H](C[C@H](CC1SCCCS1)OC)OC)OC)OC |
| InChI | InChI=1S/C21H42O4S2/c1-6-9-17(22-2)10-7-11-18(23-3)14-19(24-4)15-20(25-5)16-21-26-12-8-13-27-21/h17-21H,6-16H2,1-5H3/t17-,18-,19-,20-/m1/s1 |
| InChIKey | CZPZGLQBOLLNGY-UAFMIMERSA-N |
| XLogP | 5.38 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.70 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |