C23H35IN4O2S — CID 109387824
1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-2-methyl-3-(2-methyl-2-thiophen-2-ylpropyl)guanidine;hydroiodide (PubChem CID 109387824) has the molecular formula C23H35IN4O2S and a molecular weight of 558.53 g/mol. Its IUPAC name is 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-2-methyl-3-(2-methyl-2-thiophen-2-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-2-methyl-3-(2-methyl-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109387824 |
| Molecular Formula | C23H35IN4O2S |
| Molecular Weight | 558.53 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-2-methyl-3-(2-methyl-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCC(C)(C)c1cccs1)NC1CCN(c2cc(OC)cc(OC)c2)CC1.I |
| InChI | InChI=1S/C23H34N4O2S.HI/c1-23(2,21-7-6-12-30-21)16-25-22(24-3)26-17-8-10-27(11-9-17)18-13-19(28-4)15-20(14-18)29-5;/h6-7,12-15,17H,8-11,16H2,1-5H3,(H2,24,25,26);1H |
| InChIKey | JFXIMGQUODOZNW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|