C17H17F2NO3 — CID 109388608
4-(3,4-difluorophenoxy)-N-(1-hydroxypropan-2-yl)-N-methylbenzamide (PubChem CID 109388608) has the molecular formula C17H17F2NO3 and a molecular weight of 321.32 g/mol. Its IUPAC name is 4-(3,4-difluorophenoxy)-N-(1-hydroxypropan-2-yl)-N-methylbenzamide.
| Compound Name | 4-(3,4-difluorophenoxy)-N-(1-hydroxypropan-2-yl)-N-methylbenzamide |
|---|---|
| PubChem CID | 109388608 |
| Molecular Formula | C17H17F2NO3 |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 4-(3,4-difluorophenoxy)-N-(1-hydroxypropan-2-yl)-N-methylbenzamide |
| SMILES | CC(CO)N(C)C(=O)c1ccc(Oc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C17H17F2NO3/c1-11(10-21)20(2)17(22)12-3-5-13(6-4-12)23-14-7-8-15(18)16(19)9-14/h3-9,11,21H,10H2,1-2H3 |
| InChIKey | WNXDFTGDKLWSJL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |