C18H27NO3 — CID 109388759
N-cyclooctyl-2-[3-(hydroxymethyl)phenoxy]propanamide (PubChem CID 109388759) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is N-cyclooctyl-2-[3-(hydroxymethyl)phenoxy]propanamide.
| Compound Name | N-cyclooctyl-2-[3-(hydroxymethyl)phenoxy]propanamide |
|---|---|
| PubChem CID | 109388759 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | N-cyclooctyl-2-[3-(hydroxymethyl)phenoxy]propanamide |
| SMILES | CC(Oc1cccc(CO)c1)C(=O)NC1CCCCCCC1 |
| InChI | InChI=1S/C18H27NO3/c1-14(22-17-11-7-8-15(12-17)13-20)18(21)19-16-9-5-3-2-4-6-10-16/h7-8,11-12,14,16,20H,2-6,9-10,13H2,1H3,(H,19,21) |
| InChIKey | HJTXTPAUEHJFTQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |