C18H27N3O2 — CID 109389003
1-[1-(4-cyanophenyl)ethyl]-3-(3-hydroxy-2,2,4-trimethylpentyl)urea (PubChem CID 109389003) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 1-[1-(4-cyanophenyl)ethyl]-3-(3-hydroxy-2,2,4-trimethylpentyl)urea.
| Compound Name | 1-[1-(4-cyanophenyl)ethyl]-3-(3-hydroxy-2,2,4-trimethylpentyl)urea |
|---|---|
| PubChem CID | 109389003 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 1-[1-(4-cyanophenyl)ethyl]-3-(3-hydroxy-2,2,4-trimethylpentyl)urea |
| SMILES | CC(NC(=O)NCC(C)(C)C(O)C(C)C)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C18H27N3O2/c1-12(2)16(22)18(4,5)11-20-17(23)21-13(3)15-8-6-14(10-19)7-9-15/h6-9,12-13,16,22H,11H2,1-5H3,(H2,20,21,23) |
| InChIKey | IPEIEQBINVIOKR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |