C11H13FN2O2 — CID 109389046
6-fluoro-N-[(1-hydroxycyclobutyl)methyl]pyridine-2-carboxamide (PubChem CID 109389046) has the molecular formula C11H13FN2O2 and a molecular weight of 224.23 g/mol. Its IUPAC name is 6-fluoro-N-[(1-hydroxycyclobutyl)methyl]pyridine-2-carboxamide.
| Compound Name | 6-fluoro-N-[(1-hydroxycyclobutyl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109389046 |
| Molecular Formula | C11H13FN2O2 |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 6-fluoro-N-[(1-hydroxycyclobutyl)methyl]pyridine-2-carboxamide |
| SMILES | O=C(NCC1(O)CCC1)c1cccc(F)n1 |
| InChI | InChI=1S/C11H13FN2O2/c12-9-4-1-3-8(14-9)10(15)13-7-11(16)5-2-6-11/h1,3-4,16H,2,5-7H2,(H,13,15) |
| InChIKey | QLPPQIYFRZDPEW-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|