C25H31FO3S — CID 10938920
(2E,4E)-5-[3-[2-(3-fluoropropoxy)-3,5-di(propan-2-yl)phenyl]thiophen-2-yl]-3-methylpenta-2,4-dienoic acid (PubChem CID 10938920) has the molecular formula C25H31FO3S and a molecular weight of 430.59 g/mol. Its IUPAC name is (2E,4E)-5-[3-[2-(3-fluoropropoxy)-3,5-di(propan-2-yl)phenyl]thiophen-2-yl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-[3-[2-(3-fluoropropoxy)-3,5-di(propan-2-yl)phenyl]thiophen-2-yl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 10938920 |
| Molecular Formula | C25H31FO3S |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | (2E,4E)-5-[3-[2-(3-fluoropropoxy)-3,5-di(propan-2-yl)phenyl]thiophen-2-yl]-3-methylpenta-2,4-dienoic acid |
| SMILES | CC(/C=C/c1sccc1-c1cc(C(C)C)cc(C(C)C)c1OCCCF)=C\C(=O)O |
| InChI | InChI=1S/C25H31FO3S/c1-16(2)19-14-21(17(3)4)25(29-11-6-10-26)22(15-19)20-9-12-30-23(20)8-7-18(5)13-24(27)28/h7-9,12-17H,6,10-11H2,1-5H3,(H,27,28)/b8-7+,18-13+ |
| InChIKey | APFANXIWFMCXJQ-OZOLYBCPSA-N |
| XLogP | 7.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|