C24H31N5 — CID 109389609
2-(2,3-diphenylpropyl)-1-ethyl-3-[2-(1-methylpyrazol-4-yl)ethyl]guanidine (PubChem CID 109389609) has the molecular formula C24H31N5 and a molecular weight of 389.55 g/mol. Its IUPAC name is 2-(2,3-diphenylpropyl)-1-ethyl-3-[2-(1-methylpyrazol-4-yl)ethyl]guanidine.
| Compound Name | 2-(2,3-diphenylpropyl)-1-ethyl-3-[2-(1-methylpyrazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 109389609 |
| Molecular Formula | C24H31N5 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | 2-(2,3-diphenylpropyl)-1-ethyl-3-[2-(1-methylpyrazol-4-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CC(Cc1ccccc1)c1ccccc1)NCCc1cnn(C)c1 |
| InChI | InChI=1S/C24H31N5/c1-3-25-24(26-15-14-21-17-28-29(2)19-21)27-18-23(22-12-8-5-9-13-22)16-20-10-6-4-7-11-20/h4-13,17,19,23H,3,14-16,18H2,1-2H3,(H2,25,26,27) |
| InChIKey | NYECJWUCJNHNAS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|