C16H24F3N3O2 — CID 109389958
1-[2-[butan-2-yl(methyl)amino]ethyl]-3-[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]urea (PubChem CID 109389958) has the molecular formula C16H24F3N3O2 and a molecular weight of 347.38 g/mol. Its IUPAC name is 1-[2-[butan-2-yl(methyl)amino]ethyl]-3-[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]urea.
| Compound Name | 1-[2-[butan-2-yl(methyl)amino]ethyl]-3-[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 109389958 |
| Molecular Formula | C16H24F3N3O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 1-[2-[butan-2-yl(methyl)amino]ethyl]-3-[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]urea |
| SMILES | CCC(C)N(C)CCNC(=O)NC(CO)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C16H24F3N3O2/c1-4-10(2)22(3)6-5-20-16(24)21-14(9-23)11-7-12(17)15(19)13(18)8-11/h7-8,10,14,23H,4-6,9H2,1-3H3,(H2,20,21,24) |
| InChIKey | METBGVLZMIHIGZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|