C23H25FeNO4 — CID 10938998
(4bR,8aR)-1-heptyl-2-methyl-4b,8a-dihydrocarbazol-3-one;carbon monoxide;iron (PubChem CID 10938998) has the molecular formula C23H25FeNO4 and a molecular weight of 435.30 g/mol. Its IUPAC name is (4bR,8aR)-1-heptyl-2-methyl-4b,8a-dihydrocarbazol-3-one;carbon monoxide;iron.
| Compound Name | (4bR,8aR)-1-heptyl-2-methyl-4b,8a-dihydrocarbazol-3-one;carbon monoxide;iron |
|---|---|
| PubChem CID | 10938998 |
| Molecular Formula | C23H25FeNO4 |
| Molecular Weight | 435.30 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | (4bR,8aR)-1-heptyl-2-methyl-4b,8a-dihydrocarbazol-3-one;carbon monoxide;iron |
| SMILES | CCCCCCCC1=C(C)C(=O)C=C2C1=N[C@@H]1C=CC=C[C@H]21.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe] |
| InChI | InChI=1S/C20H25NO.3CO.Fe/c1-3-4-5-6-7-10-15-14(2)19(22)13-17-16-11-8-9-12-18(16)21-20(15)17;3*1-2;/h8-9,11-13,16,18H,3-7,10H2,1-2H3;;;;/t16-,18-;;;;/m1..../s1 |
| InChIKey | YADZZGFHBIERHR-NBWQZYPOSA-N |
| XLogP | 4.62 |
| TPSA | 89.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.30 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|