C16H26N2O3 — CID 109390126
3-(5-hydroxypentan-2-yl)-1-[1-(4-hydroxyphenyl)propan-2-yl]-1-methylurea (PubChem CID 109390126) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is 3-(5-hydroxypentan-2-yl)-1-[1-(4-hydroxyphenyl)propan-2-yl]-1-methylurea.
| Compound Name | 3-(5-hydroxypentan-2-yl)-1-[1-(4-hydroxyphenyl)propan-2-yl]-1-methylurea |
|---|---|
| PubChem CID | 109390126 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 3-(5-hydroxypentan-2-yl)-1-[1-(4-hydroxyphenyl)propan-2-yl]-1-methylurea |
| SMILES | CC(CCCO)NC(=O)N(C)C(C)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C16H26N2O3/c1-12(5-4-10-19)17-16(21)18(3)13(2)11-14-6-8-15(20)9-7-14/h6-9,12-13,19-20H,4-5,10-11H2,1-3H3,(H,17,21) |
| InChIKey | IYLQLDHVZDHIEW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |