C15H19F3N2O2S — CID 109390136
1-[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-3-[(2-methylthiolan-2-yl)methyl]urea (PubChem CID 109390136) has the molecular formula C15H19F3N2O2S and a molecular weight of 348.39 g/mol. Its IUPAC name is 1-[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-3-[(2-methylthiolan-2-yl)methyl]urea.
| Compound Name | 1-[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-3-[(2-methylthiolan-2-yl)methyl]urea |
|---|---|
| PubChem CID | 109390136 |
| Molecular Formula | C15H19F3N2O2S |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 1-[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-3-[(2-methylthiolan-2-yl)methyl]urea |
| SMILES | CC1(CNC(=O)NC(CO)c2cc(F)c(F)c(F)c2)CCCS1 |
| InChI | InChI=1S/C15H19F3N2O2S/c1-15(3-2-4-23-15)8-19-14(22)20-12(7-21)9-5-10(16)13(18)11(17)6-9/h5-6,12,21H,2-4,7-8H2,1H3,(H2,19,20,22) |
| InChIKey | SCBYXASOALDTGP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|