C22H41IN6O — CID 109390373
1-(3-ethoxy-2,2-diethylcyclobutyl)-2-methyl-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine;hydroiodide (PubChem CID 109390373) has the molecular formula C22H41IN6O and a molecular weight of 532.52 g/mol. Its IUPAC name is 1-(3-ethoxy-2,2-diethylcyclobutyl)-2-methyl-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-(3-ethoxy-2,2-diethylcyclobutyl)-2-methyl-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109390373 |
| Molecular Formula | C22H41IN6O |
| Molecular Weight | 532.52 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | 1-(3-ethoxy-2,2-diethylcyclobutyl)-2-methyl-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine;hydroiodide |
| SMILES | CCOC1CC(N/C(=N/C)NCCCc2nnc3n2CCCCC3)C1(CC)CC.I |
| InChI | InChI=1S/C22H40N6O.HI/c1-5-22(6-2)17(16-18(22)29-7-3)25-21(23-4)24-14-11-13-20-27-26-19-12-9-8-10-15-28(19)20;/h17-18H,5-16H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | BGYSCAGOUOHPAX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|