About 1-(3-ethoxy-2,2-diethylcyclobutyl)-3-(3-fluoropropyl)-2-methylguanidine
1-(3-ethoxy-2,2-diethylcyclobutyl)-3-(3-fluoropropyl)-2-methylguanidine (PubChem CID 109390666) has the molecular formula C15H30FN3O
and a molecular weight of 287.42 g/mol. Its IUPAC name is 1-(3-ethoxy-2,2-diethylcyclobutyl)-3-(3-fluoropropyl)-2-methylguanidine.
Molecular Properties
| Compound Name | 1-(3-ethoxy-2,2-diethylcyclobutyl)-3-(3-fluoropropyl)-2-methylguanidine |
| PubChem CID | 109390666 |
| Molecular Formula | C15H30FN3O |
| Molecular Weight | 287.42 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | 1-(3-ethoxy-2,2-diethylcyclobutyl)-3-(3-fluoropropyl)-2-methylguanidine |
| SMILES | CCOC1CC(N/C(=N/C)NCCCF)C1(CC)CC |
| InChI | InChI=1S/C15H30FN3O/c1-5-15(6-2)12(11-13(15)20-7-3)19-14(17-4)18-10-8-9-16/h12-13H,5-11H2,1-4H3,(H2,17,18,19) |
| InChIKey | XLTGTQXZBDJFEF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-ethoxy-2,2-diethylcyclobutyl)-3-(3-fluoropropyl)-2-methylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-ethoxy-2,2-diethylcyclobutyl)-3-(3-fluoropropyl)-2-methylguanidine?
The IUPAC name of 1-(3-ethoxy-2,2-diethylcyclobutyl)-3-(3-fluoropropyl)-2-methylguanidine (CID 109390666) is 1-(3-ethoxy-2,2-diethylcyclobutyl)-3-(3-fluoropropyl)-2-methylguanidine.
What is the SMILES notation for 1-(3-ethoxy-2,2-diethylcyclobutyl)-3-(3-fluoropropyl)-2-methylguanidine?
The canonical SMILES for 1-(3-ethoxy-2,2-diethylcyclobutyl)-3-(3-fluoropropyl)-2-methylguanidine is CCOC1CC(N/C(=N/C)NCCCF)C1(CC)CC.
What is the InChIKey of 1-(3-ethoxy-2,2-diethylcyclobutyl)-3-(3-fluoropropyl)-2-methylguanidine?
The InChIKey is XLTGTQXZBDJFEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30FN3O/c1-5-15(6-2)12(11-13(15)20-7-3)19-14(17-4)18-10-8-9-16/h12-13H,5-11H2,1-4H3,(H2,17,18,19).
What are the key properties of 1-(3-ethoxy-2,2-diethylcyclobutyl)-3-(3-fluoropropyl)-2-methylguanidine?
1-(3-ethoxy-2,2-diethylcyclobutyl)-3-(3-fluoropropyl)-2-methylguanidine has a molecular weight of 287.42 g/mol, XLogP of 2.49, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-ethoxy-2,2-diethylcyclobutyl)-3-(3-fluoropropyl)-2-methylguanidine is sourced from PubChem (CID 109390666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).