C27H24N2O4 — CID 10939104
dimethyl (1S,2S,3S,7R,8S,9R)-4,6-diphenyl-4,5-diazatetracyclo[7.2.2.02,8.03,7]trideca-5,10,12-triene-10,11-dicarboxylate (PubChem CID 10939104) has the molecular formula C27H24N2O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is dimethyl (1S,2S,3S,7R,8S,9R)-4,6-diphenyl-4,5-diazatetracyclo[7.2.2.02,8.03,7]trideca-5,10,12-triene-10,11-dicarboxylate.
| Compound Name | dimethyl (1S,2S,3S,7R,8S,9R)-4,6-diphenyl-4,5-diazatetracyclo[7.2.2.02,8.03,7]trideca-5,10,12-triene-10,11-dicarboxylate |
|---|---|
| PubChem CID | 10939104 |
| Molecular Formula | C27H24N2O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | dimethyl (1S,2S,3S,7R,8S,9R)-4,6-diphenyl-4,5-diazatetracyclo[7.2.2.02,8.03,7]trideca-5,10,12-triene-10,11-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@H]2C=C[C@H]1[C@@H]1[C@H]2[C@H]2C(c3ccccc3)=NN(c3ccccc3)[C@H]21 |
| InChI | InChI=1S/C27H24N2O4/c1-32-26(30)21-17-13-14-18(22(21)27(31)33-2)20-19(17)23-24(15-9-5-3-6-10-15)28-29(25(20)23)16-11-7-4-8-12-16/h3-14,17-20,23,25H,1-2H3/t17-,18+,19+,20-,23+,25+/m1/s1 |
| InChIKey | VDMWKUGXRAHBSR-PVPQCWPQSA-N |
| XLogP | 3.60 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|