C32H56 — CID 10939121
1,2,3,4,5,6,7,8-octapropyltricyclo[4.2.0.02,5]octa-3,7-diene (PubChem CID 10939121) has the molecular formula C32H56 and a molecular weight of 440.80 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octapropyltricyclo[4.2.0.02,5]octa-3,7-diene.
| Compound Name | 1,2,3,4,5,6,7,8-octapropyltricyclo[4.2.0.02,5]octa-3,7-diene |
|---|---|
| PubChem CID | 10939121 |
| Molecular Formula | C32H56 |
| Molecular Weight | 440.80 g/mol |
| Exact Mass | 440.44 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octapropyltricyclo[4.2.0.02,5]octa-3,7-diene |
| SMILES | CCCC1=C(CCC)C2(CCC)C1(CCC)C1(CCC)C(CCC)=C(CCC)C21CCC |
| InChI | InChI=1S/C32H56/c1-9-17-25-26(18-10-2)30(22-14-6)29(25,21-13-5)31(23-15-7)27(19-11-3)28(20-12-4)32(30,31)24-16-8/h9-24H2,1-8H3 |
| InChIKey | SYJJVLXWAQNYAH-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.80 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|