C26H34O6 — CID 10939149
(4R)-4-[(1R,2R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,2-bis(phenylmethoxy)ethyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 10939149) has the molecular formula C26H34O6 and a molecular weight of 442.55 g/mol. Its IUPAC name is (4R)-4-[(1R,2R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,2-bis(phenylmethoxy)ethyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R)-4-[(1R,2R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,2-bis(phenylmethoxy)ethyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 10939149 |
| Molecular Formula | C26H34O6 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | (4R)-4-[(1R,2R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,2-bis(phenylmethoxy)ethyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)OC[C@H]([C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C26H34O6/c1-25(2)29-17-21(31-25)23(27-15-19-11-7-5-8-12-19)24(22-18-30-26(3,4)32-22)28-16-20-13-9-6-10-14-20/h5-14,21-24H,15-18H2,1-4H3/t21-,22-,23-,24-/m1/s1 |
| InChIKey | LEAIDEHFLNKGBI-MOUTVQLLSA-N |
| XLogP | 4.46 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |