C17H24Cl2IN3O — CID 109392165
1-[(3,4-dichlorophenyl)methyl]-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 109392165) has the molecular formula C17H24Cl2IN3O and a molecular weight of 484.21 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109392165 |
| Molecular Formula | C17H24Cl2IN3O |
| Molecular Weight | 484.21 g/mol |
| Exact Mass | 483.03 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCC1=CCOCC1)N(C)Cc1ccc(Cl)c(Cl)c1.I |
| InChI | InChI=1S/C17H23Cl2N3O.HI/c1-20-17(21-8-5-13-6-9-23-10-7-13)22(2)12-14-3-4-15(18)16(19)11-14;/h3-4,6,11H,5,7-10,12H2,1-2H3,(H,20,21);1H |
| InChIKey | DCRJVUQFRBEKFI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.21 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|