C22H28BrN3O2 — CID 10939222
4-bromo-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]benzamide (PubChem CID 10939222) has the molecular formula C22H28BrN3O2 and a molecular weight of 446.39 g/mol. Its IUPAC name is 4-bromo-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]benzamide.
| Compound Name | 4-bromo-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]benzamide |
|---|---|
| PubChem CID | 10939222 |
| Molecular Formula | C22H28BrN3O2 |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 4-bromo-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]benzamide |
| SMILES | COc1ccccc1N1CCN(CCCCNC(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C22H28BrN3O2/c1-28-21-7-3-2-6-20(21)26-16-14-25(15-17-26)13-5-4-12-24-22(27)18-8-10-19(23)11-9-18/h2-3,6-11H,4-5,12-17H2,1H3,(H,24,27) |
| InChIKey | ZGEMRFRKWCDFJH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|