C18H26Cl2IN3O — CID 109392291
1-[1-(3,4-dichlorophenyl)ethyl]-2-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethylguanidine;hydroiodide (PubChem CID 109392291) has the molecular formula C18H26Cl2IN3O and a molecular weight of 498.24 g/mol. Its IUPAC name is 1-[1-(3,4-dichlorophenyl)ethyl]-2-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[1-(3,4-dichlorophenyl)ethyl]-2-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109392291 |
| Molecular Formula | C18H26Cl2IN3O |
| Molecular Weight | 498.24 g/mol |
| Exact Mass | 497.05 |
| IUPAC Name | 1-[1-(3,4-dichlorophenyl)ethyl]-2-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCC1=CCOCC1)NC(C)c1ccc(Cl)c(Cl)c1.I |
| InChI | InChI=1S/C18H25Cl2N3O.HI/c1-3-21-18(22-9-6-14-7-10-24-11-8-14)23-13(2)15-4-5-16(19)17(20)12-15;/h4-5,7,12-13H,3,6,8-11H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | ZXCWXXJOZUYXKN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.24 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|