C17H23Cl2N3O — CID 109392294
1-[1-(3,4-dichlorophenyl)ethyl]-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methylguanidine (PubChem CID 109392294) has the molecular formula C17H23Cl2N3O and a molecular weight of 356.30 g/mol. Its IUPAC name is 1-[1-(3,4-dichlorophenyl)ethyl]-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[1-(3,4-dichlorophenyl)ethyl]-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 109392294 |
| Molecular Formula | C17H23Cl2N3O |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 1-[1-(3,4-dichlorophenyl)ethyl]-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCC1=CCOCC1)NC(C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H23Cl2N3O/c1-12(14-3-4-15(18)16(19)11-14)22-17(20-2)21-8-5-13-6-9-23-10-7-13/h3-4,6,11-12H,5,7-10H2,1-2H3,(H2,20,21,22) |
| InChIKey | PGLVNNSNSGBOLQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|