C22H25Cl3N2O2 — CID 10939405
2,2,2-trichloroethyl (1S,9S,12R,19S)-12-ethyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,13-tetraene-8-carboxylate (PubChem CID 10939405) has the molecular formula C22H25Cl3N2O2 and a molecular weight of 455.81 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (1S,9S,12R,19S)-12-ethyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,13-tetraene-8-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (1S,9S,12R,19S)-12-ethyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,13-tetraene-8-carboxylate |
|---|---|
| PubChem CID | 10939405 |
| Molecular Formula | C22H25Cl3N2O2 |
| Molecular Weight | 455.81 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 2,2,2-trichloroethyl (1S,9S,12R,19S)-12-ethyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,13-tetraene-8-carboxylate |
| SMILES | CC[C@]12C=CCN3CC[C@@]4(c5ccccc5N(C(=O)OCC(Cl)(Cl)Cl)[C@H]4CC1)[C@@H]32 |
| InChI | InChI=1S/C22H25Cl3N2O2/c1-2-20-9-5-12-26-13-11-21(18(20)26)15-6-3-4-7-16(15)27(17(21)8-10-20)19(28)29-14-22(23,24)25/h3-7,9,17-18H,2,8,10-14H2,1H3/t17-,18-,20-,21-/m0/s1 |
| InChIKey | NZSOCOMVNCYBGY-QIJZPMMNSA-N |
| XLogP | 5.45 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.81 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|