C18H32N4O — CID 109394337
2-[(1-ethylpyrrolidin-2-yl)methyl]-1-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine (PubChem CID 109394337) has the molecular formula C18H32N4O and a molecular weight of 320.48 g/mol. Its IUPAC name is 2-[(1-ethylpyrrolidin-2-yl)methyl]-1-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine.
| Compound Name | 2-[(1-ethylpyrrolidin-2-yl)methyl]-1-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine |
|---|---|
| PubChem CID | 109394337 |
| Molecular Formula | C18H32N4O |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.26 |
| IUPAC Name | 2-[(1-ethylpyrrolidin-2-yl)methyl]-1-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine |
| SMILES | CCN1CCCC1C/N=C(\N)NC1C2CCOC2C12CCCC2 |
| InChI | InChI=1S/C18H32N4O/c1-2-22-10-5-6-13(22)12-20-17(19)21-15-14-7-11-23-16(14)18(15)8-3-4-9-18/h13-16H,2-12H2,1H3,(H3,19,20,21) |
| InChIKey | AXAXECOTJVXJLL-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|