C17H33F2N5O2S — CID 109394974
1-[1-(2,2-difluoroethyl)piperidin-4-yl]-3-ethyl-2-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine (PubChem CID 109394974) has the molecular formula C17H33F2N5O2S and a molecular weight of 409.55 g/mol. Its IUPAC name is 1-[1-(2,2-difluoroethyl)piperidin-4-yl]-3-ethyl-2-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine.
| Compound Name | 1-[1-(2,2-difluoroethyl)piperidin-4-yl]-3-ethyl-2-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109394974 |
| Molecular Formula | C17H33F2N5O2S |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 1-[1-(2,2-difluoroethyl)piperidin-4-yl]-3-ethyl-2-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CC1CCN(S(C)(=O)=O)CC1)NC1CCN(CC(F)F)CC1 |
| InChI | InChI=1S/C17H33F2N5O2S/c1-3-20-17(22-15-6-8-23(9-7-15)13-16(18)19)21-12-14-4-10-24(11-5-14)27(2,25)26/h14-16H,3-13H2,1-2H3,(H2,20,21,22) |
| InChIKey | NRIWBNZMBAEYMO-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|