C28H50O3Si — CID 10939523
(3S)-3-[(2R,4aS,4bS,7S,8aR,10aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,4b-dimethyl-1-oxo-4,4a,5,6,7,8,8a,9,10,10a-decahydro-3H-phenanthren-2-yl]hexanal (PubChem CID 10939523) has the molecular formula C28H50O3Si and a molecular weight of 462.79 g/mol. Its IUPAC name is (3S)-3-[(2R,4aS,4bS,7S,8aR,10aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,4b-dimethyl-1-oxo-4,4a,5,6,7,8,8a,9,10,10a-decahydro-3H-phenanthren-2-yl]hexanal.
| Compound Name | (3S)-3-[(2R,4aS,4bS,7S,8aR,10aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,4b-dimethyl-1-oxo-4,4a,5,6,7,8,8a,9,10,10a-decahydro-3H-phenanthren-2-yl]hexanal |
|---|---|
| PubChem CID | 10939523 |
| Molecular Formula | C28H50O3Si |
| Molecular Weight | 462.79 g/mol |
| Exact Mass | 462.35 |
| IUPAC Name | (3S)-3-[(2R,4aS,4bS,7S,8aR,10aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,4b-dimethyl-1-oxo-4,4a,5,6,7,8,8a,9,10,10a-decahydro-3H-phenanthren-2-yl]hexanal |
| SMILES | CCC[C@@H](CC=O)[C@@]1(C)CC[C@H]2[C@@H](CC[C@@H]3C[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@]32C)C1=O |
| InChI | InChI=1S/C28H50O3Si/c1-9-10-20(15-18-29)28(6)17-14-24-23(25(28)30)12-11-21-19-22(13-16-27(21,24)5)31-32(7,8)26(2,3)4/h18,20-24H,9-17,19H2,1-8H3/t20-,21+,22-,23+,24-,27-,28+/m0/s1 |
| InChIKey | XMRMDJSBQVQPCI-RJEOTYLSSA-N |
| XLogP | 7.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.79 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|