C20H23F2NO2 — CID 109395452
1-(3,4-difluorophenyl)-2-[[2-(oxolan-3-yl)-1-phenylethyl]amino]ethanol (PubChem CID 109395452) has the molecular formula C20H23F2NO2 and a molecular weight of 347.41 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-2-[[2-(oxolan-3-yl)-1-phenylethyl]amino]ethanol.
| Compound Name | 1-(3,4-difluorophenyl)-2-[[2-(oxolan-3-yl)-1-phenylethyl]amino]ethanol |
|---|---|
| PubChem CID | 109395452 |
| Molecular Formula | C20H23F2NO2 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 1-(3,4-difluorophenyl)-2-[[2-(oxolan-3-yl)-1-phenylethyl]amino]ethanol |
| SMILES | OC(CNC(CC1CCOC1)c1ccccc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H23F2NO2/c21-17-7-6-16(11-18(17)22)20(24)12-23-19(10-14-8-9-25-13-14)15-4-2-1-3-5-15/h1-7,11,14,19-20,23-24H,8-10,12-13H2 |
| InChIKey | VYJNIHGGEMMAKV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |