C18H35F3IN5O2S — CID 109395915
2-methyl-1-[(1-methylsulfonylpiperidin-4-yl)methyl]-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine;hydroiodide (PubChem CID 109395915) has the molecular formula C18H35F3IN5O2S and a molecular weight of 569.48 g/mol. Its IUPAC name is 2-methyl-1-[(1-methylsulfonylpiperidin-4-yl)methyl]-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(1-methylsulfonylpiperidin-4-yl)methyl]-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109395915 |
| Molecular Formula | C18H35F3IN5O2S |
| Molecular Weight | 569.48 g/mol |
| Exact Mass | 569.15 |
| IUPAC Name | 2-methyl-1-[(1-methylsulfonylpiperidin-4-yl)methyl]-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC1CCN(CC(F)(F)F)CC1)NCC1CCN(S(C)(=O)=O)CC1.I |
| InChI | InChI=1S/C18H34F3N5O2S.HI/c1-22-17(24-13-16-6-11-26(12-7-16)29(2,27)28)23-8-3-15-4-9-25(10-5-15)14-18(19,20)21;/h15-16H,3-14H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | HERFYHZNDSHUAI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|