About 2-ethyl-2-(thieno[3,2-b]pyridin-6-ylmethylamino)butan-1-ol
2-ethyl-2-(thieno[3,2-b]pyridin-6-ylmethylamino)butan-1-ol (PubChem CID 109396214) has the molecular formula C14H20N2OS
and a molecular weight of 264.39 g/mol. Its IUPAC name is 2-ethyl-2-(thieno[3,2-b]pyridin-6-ylmethylamino)butan-1-ol.
Molecular Properties
| Compound Name | 2-ethyl-2-(thieno[3,2-b]pyridin-6-ylmethylamino)butan-1-ol |
| PubChem CID | 109396214 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 2-ethyl-2-(thieno[3,2-b]pyridin-6-ylmethylamino)butan-1-ol |
| SMILES | CCC(CC)(CO)NCc1cnc2ccsc2c1 |
| InChI | InChI=1S/C14H20N2OS/c1-3-14(4-2,10-17)16-9-11-7-13-12(15-8-11)5-6-18-13/h5-8,16-17H,3-4,9-10H2,1-2H3 |
| InChIKey | NKIFMTCMHCJYIX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethyl-2-(thieno[3,2-b]pyridin-6-ylmethylamino)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2-(thieno[3,2-b]pyridin-6-ylmethylamino)butan-1-ol?
The IUPAC name of 2-ethyl-2-(thieno[3,2-b]pyridin-6-ylmethylamino)butan-1-ol (CID 109396214) is 2-ethyl-2-(thieno[3,2-b]pyridin-6-ylmethylamino)butan-1-ol.
What is the SMILES notation for 2-ethyl-2-(thieno[3,2-b]pyridin-6-ylmethylamino)butan-1-ol?
The canonical SMILES for 2-ethyl-2-(thieno[3,2-b]pyridin-6-ylmethylamino)butan-1-ol is CCC(CC)(CO)NCc1cnc2ccsc2c1.
What is the InChIKey of 2-ethyl-2-(thieno[3,2-b]pyridin-6-ylmethylamino)butan-1-ol?
The InChIKey is NKIFMTCMHCJYIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2OS/c1-3-14(4-2,10-17)16-9-11-7-13-12(15-8-11)5-6-18-13/h5-8,16-17H,3-4,9-10H2,1-2H3.
What are the key properties of 2-ethyl-2-(thieno[3,2-b]pyridin-6-ylmethylamino)butan-1-ol?
2-ethyl-2-(thieno[3,2-b]pyridin-6-ylmethylamino)butan-1-ol has a molecular weight of 264.39 g/mol, XLogP of 2.94, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2-(thieno[3,2-b]pyridin-6-ylmethylamino)butan-1-ol is sourced from PubChem (CID 109396214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).