C22H21F5O4S — CID 10939712
(Z,3S)-4-methyl-6-methylsulfonyl-3-[(1S)-1-(2,3,4,5,6-pentafluorophenyl)ethoxy]-1-phenylhex-4-en-1-one (PubChem CID 10939712) has the molecular formula C22H21F5O4S and a molecular weight of 476.46 g/mol. Its IUPAC name is (Z,3S)-4-methyl-6-methylsulfonyl-3-[(1S)-1-(2,3,4,5,6-pentafluorophenyl)ethoxy]-1-phenylhex-4-en-1-one.
| Compound Name | (Z,3S)-4-methyl-6-methylsulfonyl-3-[(1S)-1-(2,3,4,5,6-pentafluorophenyl)ethoxy]-1-phenylhex-4-en-1-one |
|---|---|
| PubChem CID | 10939712 |
| Molecular Formula | C22H21F5O4S |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | (Z,3S)-4-methyl-6-methylsulfonyl-3-[(1S)-1-(2,3,4,5,6-pentafluorophenyl)ethoxy]-1-phenylhex-4-en-1-one |
| SMILES | C/C(=C/CS(C)(=O)=O)[C@H](CC(=O)c1ccccc1)O[C@@H](C)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C22H21F5O4S/c1-12(9-10-32(3,29)30)16(11-15(28)14-7-5-4-6-8-14)31-13(2)17-18(23)20(25)22(27)21(26)19(17)24/h4-9,13,16H,10-11H2,1-3H3/b12-9-/t13-,16-/m0/s1 |
| InChIKey | AHQKBQMTTXGCMJ-UFDVIRIBSA-N |
| XLogP | 5.09 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|